cas: 2246691-45-0 — see every product listed under this CAS number, including other names
1-Methyl-4-(2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)ethyl)piperazine, 95%, 95% (CAS 2246691-45-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTN3-100mg |
| cas | 2246691-45-0 |
| size | 100mg |
| availability | 0.65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine (CAS 2246691-45-0) is a chemical compound with the molecular formula C19H31BN2O3 and a molecular weight of 346.3 g/mol. IUPAC name: 1-methyl-4-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine. InChIKey: NYDXKUYOGZPHCG-UHFFFAOYSA-N.
| Molecular formula | C19H31BN2O3 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 1-methyl-4-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperazine |
| InChIKey | NYDXKUYOGZPHCG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCN3CCN(CC3)C |
Computed by PubChem (NCBI)