cas: 571189-49-6 — see every product listed under this CAS number, including other names
1-Methyl-4-(6-aminopyridin-3-yl)piperazine, 95% (CAS 571189-49-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076770-1G |
| cas | 571189-49-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 404.04 Pln | |
| Fluorochem | 100g | 1330.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-(4-methylpiperazin-1-yl)pyridin-2-amine (CAS 571189-49-6) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 5-(4-methylpiperazin-1-yl)pyridin-2-amine. InChIKey: QDMPMBFLXOWHRY-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 5-(4-methylpiperazin-1-yl)pyridin-2-amine |
| InChIKey | QDMPMBFLXOWHRY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)