1-Methyl-4-(pyrrolidin-2-ylmethyl)piperazine dihydrochloride, 95%
cas: 1219960-65-2 — see every product listed under this CAS number, including other names
1-Methyl-4-(pyrrolidin-2-ylmethyl)piperazine dihydrochloride, 95% (CAS 1219960-65-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A134915-250mg |
| cas | 1219960-65-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 754.19 Pln | |
| Ambeed | 5g | 2795.62 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 736.43 Pln | |
| BLDpharm | 5g | 2757.94 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 866.00 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 653.95 Pln | |
| Fluorochem | 1g | 1611.95 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-4-(pyrrolidin-2-ylmethyl)piperazine;dihydrochloride (CAS 1219960-65-2) is a chemical compound with the molecular formula C10H23Cl2N3 and a molecular weight of 256.21 g/mol. IUPAC name: 1-methyl-4-(pyrrolidin-2-ylmethyl)piperazine;dihydrochloride. InChIKey: NWJFWTWIIPNWEO-UHFFFAOYSA-N.
| Molecular formula | C10H23Cl2N3 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 1-methyl-4-(pyrrolidin-2-ylmethyl)piperazine;dihydrochloride |
| InChIKey | NWJFWTWIIPNWEO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-methyl-4-(pyrrolidin-2-ylmethyl)piperazine dihydrochloride, 1-methyl-4-(2-pyrrolidinylmethyl)piperazine dihydrochloride, 1-Methyl-4-(2-pyrrolidinylmethyl)piperazinedihydrochloride, 1-methyl-4-(pyrrolidin-2-ylmethyl)piperazine;dihydrochloride, 1-methyl-4-[(pyrrolidin-2-yl)methyl]piperazine dihydrochloride, 1-Methyl-4-(pyrrolidin-2-ylmethyl)piperazine diHCl, 1-methyl-4-(pyrrolidin-2-ylmethyl)piperazinedihydrochloride