1-Methylimidazole Trifluoromethanesulfonate, 98%
cas: 99257-94-0 — see every product listed under this CAS number, including other names
1-Methylimidazole Trifluoromethanesulfonate, 98% (CAS 99257-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100g, 1g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1149710-250mg |
| cas | 99257-94-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 100g | 7301.25 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 10g | 698.00 Pln | |
| Chemat | 25g | 1547.60 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 669.79 Pln | |
| BLDpharm | 25g | 2508.03 Pln | |
| BLDpharm | 100g | 7867.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-methyl-1H-imidazol-1-ium;trifluoromethanesulfonate (CAS 99257-94-0) is a chemical compound with the molecular formula C5H7F3N2O3S and a molecular weight of 232.18 g/mol. IUPAC name: 1-methyl-1H-imidazol-1-ium;trifluoromethanesulfonate. InChIKey: QSIFOTQDNVCTTM-UHFFFAOYSA-N.
| Molecular formula | C5H7F3N2O3S |
|---|---|
| Molecular weight | 232.18 g/mol |
| IUPAC name | 1-methyl-1H-imidazol-1-ium;trifluoromethanesulfonate |
| InChIKey | QSIFOTQDNVCTTM-UHFFFAOYSA-N |
| SMILES | C[NH+]1C=CN=C1.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)
