cas: 2381-21-7 — see every product listed under this CAS number, including other names
1-Methylpyrene, 99% (CAS 2381-21-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A724124-250mg |
| cas | 2381-21-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 2589.81 Pln | |
| Ambeed | 5g | 7629.44 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2349.20 Pln | |
| Chemat | 5g | 7677.20 Pln | |
| BLDpharm | 100mg | 580.93 Pln | |
| BLDpharm | 250mg | 1036.33 Pln | |
| BLDpharm | 1g | 2785.71 Pln | |
| BLDpharm | 5g | 8222.68 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
1-Methylpyrene is a member of pyrenes.
Source: ChEBI
| Molecular formula | C17H12 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 1-methylpyrene |
| InChIKey | KBSPJIWZDWBDGM-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=CC=CC4=C3C2=C(C=C1)C=C4 |
Computed by PubChem (NCBI)