cas: 313950-41-3 — see every product listed under this CAS number, including other names
1-N-Boc-2-Isopropylpiperidin-4-one 98% (CAS 313950-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A822803-100mg |
| cas | 313950-41-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4469.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A822803 |
Tert-butyl 4-oxo-2-propan-2-ylpiperidine-1-carboxylate (CAS 313950-41-3) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 4-oxo-2-propan-2-ylpiperidine-1-carboxylate. InChIKey: GEHRUAIXGSWYPC-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 4-oxo-2-propan-2-ylpiperidine-1-carboxylate |
| InChIKey | GEHRUAIXGSWYPC-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC(=O)CCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)