cas: 884507-31-7 — see every product listed under this CAS number, including other names
1-N-Boc-4-(4-Cyanopyridin-2-yl)piperazine (CAS 884507-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048545-250MG |
| cas | 884507-31-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1736.91 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl 4-(4-cyano-2-pyridinyl)piperazine-1-carboxylate (CAS 884507-31-7) is a chemical compound with the molecular formula C15H20N4O2 and a molecular weight of 288.34 g/mol. IUPAC name: tert-butyl 4-(4-cyano-2-pyridinyl)piperazine-1-carboxylate. InChIKey: SLBLBTKJSGRVTR-UHFFFAOYSA-N.
| Molecular formula | C15H20N4O2 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | tert-butyl 4-(4-cyano-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | SLBLBTKJSGRVTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=CC(=C2)C#N |
Computed by PubChem (NCBI)