cas: 17112-82-2 — see every product listed under this CAS number, including other names
1-Naphthalenemethylisothiocyanate 97% (CAS 17112-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A890494-250mg |
| cas | 17112-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2083.62 Pln | |
| Ambeed | 10g | 3591.06 Pln | |
| Ambeed | 25g | 7112.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A890494 |
1-(isothiocyanatomethyl)naphthalene (CAS 17112-82-2) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: 1-(isothiocyanatomethyl)naphthalene. InChIKey: JJMDUNWYBZCIKZ-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 1-(isothiocyanatomethyl)naphthalene |
| InChIKey | JJMDUNWYBZCIKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN=C=S |
Computed by PubChem (NCBI)