CAS 100-13-0 appears in our catalog under these names: 4-Nitrostyrene, 97%, 4–Nitrostyrene (stabilized with TBC), 4-Nitrostyrene (stabilized with TBC), >98.0%(GC), 1-Nitro-4-vinylbenzene, 98%, 98%, 4-Nitrostyrene, 97% (stabilized with TBC). Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 250mg, 50g, 250g.
1-ethenyl-4-nitrobenzene (CAS 100-13-0) is a chemical compound with the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. IUPAC name: 1-ethenyl-4-nitrobenzene. InChIKey: YFZHODLXYNDBSM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2 |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | 1-ethenyl-4-nitrobenzene |
| InChIKey | YFZHODLXYNDBSM-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)