cas: 70775-75-6 — see every product listed under this CAS number, including other names
1-Octanamine,N,N'-(1,10-decanediyldi-1(4H)-pyridinyl-4-ylidene)bis-, hydrochloride (1:2), 98%, 98% (CAS 70775-75-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TGW-50mg |
| cas | 70775-75-6 |
| size | 50mg |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 1134.80 Pln | |
| Chemat | 500g | 4430.40 Pln | |
| Chemat | 1mg | 74.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-octyl-1-[10-(4-octylimino-1-pyridinyl)decyl]pyridin-4-imine;dihydrochloride (CAS 70775-75-6) is a chemical compound with the molecular formula C36H64Cl2N4 and a molecular weight of 623.8 g/mol. IUPAC name: N-octyl-1-[10-(4-octylimino-1-pyridinyl)decyl]pyridin-4-imine;dihydrochloride. InChIKey: SMGTYJPMKXNQFY-UHFFFAOYSA-N.
| Molecular formula | C36H64Cl2N4 |
|---|---|
| Molecular weight | 623.8 g/mol |
| IUPAC name | N-octyl-1-[10-(4-octylimino-1-pyridinyl)decyl]pyridin-4-imine;dihydrochloride |
| InChIKey | SMGTYJPMKXNQFY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN=C1C=CN(C=C1)CCCCCCCCCCN2C=CC(=NCCCCCCCC)C=C2.Cl.Cl |
Computed by PubChem (NCBI)