cas: 36640-52-5 — see every product listed under this CAS number, including other names
1-PHENYL-3-P-TOLYL-1H-PYRAZOLE-4-CARBALDEHYDE, 98.0%, 98.0% (CAS 36640-52-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D3W9-1g |
| cas | 36640-52-5 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 200mg | 83.60 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
3-(4-methylphenyl)-1-phenylpyrazole-4-carbaldehyde (CAS 36640-52-5) is a chemical compound with the molecular formula C17H14N2O and a molecular weight of 262.30 g/mol. IUPAC name: 3-(4-methylphenyl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: PUUGVPPTLNTKIM-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | PUUGVPPTLNTKIM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C=C2C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)