1-Pentanol, 4,4,5,5,5-pentafluoro-, 1-methanesulfonate, >95%, >95%
cas: 252947-01-6 — see every product listed under this CAS number, including other names
1-Pentanol, 4,4,5,5,5-pentafluoro-, 1-methanesulfonate, >95%, >95% (CAS 252947-01-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4F7-100mg |
| cas | 252947-01-6 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 664.40 Pln | |
| Chemat | 5g | 2176.40 Pln | |
| Chemat | 10g | 3813.20 Pln | |
| Chemat | 25g | 8848.40 Pln |
properties
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5,5-pentafluoropentyl methanesulfonate (CAS 252947-01-6) is a chemical compound with the molecular formula C6H9F5O3S and a molecular weight of 256.19 g/mol. IUPAC name: 4,4,5,5,5-pentafluoropentyl methanesulfonate. InChIKey: MFRVGMDZPRZPDM-UHFFFAOYSA-N.
| Molecular formula | C6H9F5O3S |
|---|---|
| Molecular weight | 256.19 g/mol |
| IUPAC name | 4,4,5,5,5-pentafluoropentyl methanesulfonate |
| InChIKey | MFRVGMDZPRZPDM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5,5-pentafluoropentyl methanesulfonate, Methanesulfonic acid 4,4,5,5,5-pentafluoro-pentyl ester, 1-Pentanol, 4,4,5,5,5-pentafluoro-, 1-methanesulfonate, 4,4,5,5,5-pentafluoropentyl methanesulphonate, Methanesulfonic acid 4,4,5,5,5-pentafluoro-pentylester, 1-Pentanol, 4,4,5,5,5-pentafluoro-, methanesulfonate (9CI), 4,4,5,5,5-pentafluoropentylmethansulfonate, 1-Methylsulfonyloxy-4,4,5,5,5-pentafluoropentane, 1-methanesulfonyloxy-4,4,5,5,5-pentafluoropentane, methanesulfonic acid4,4,5,5,5-pentafluoro-pentyl ester