cas: 17507-05-0 — see every product listed under this CAS number, including other names
1-Phenyl-1,4-dihydroisoquinolin-3(2H)-one, 98%, 98% (CAS 17507-05-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113159-100mg |
| cas | 17507-05-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1595.60 Pln | |
| Chemat | 10g | 2675.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-2,4-dihydro-1H-isoquinolin-3-one (CAS 17507-05-0) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 1-phenyl-2,4-dihydro-1H-isoquinolin-3-one. InChIKey: IAOCKKZVKNCZPK-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 1-phenyl-2,4-dihydro-1H-isoquinolin-3-one |
| InChIKey | IAOCKKZVKNCZPK-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)