cas: 1027511-69-8 — see every product listed under this CAS number, including other names
1-Piperazinecarboxylic acid, 2-butyl-, 1,1-dimethylethyl ester, 95%, 95% (CAS 1027511-69-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1119AG-100mg |
| cas | 1027511-69-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-butylpiperazine-1-carboxylate (CAS 1027511-69-8) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl 2-butylpiperazine-1-carboxylate. InChIKey: YWHDUWJBVKOUGW-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl 2-butylpiperazine-1-carboxylate |
| InChIKey | YWHDUWJBVKOUGW-UHFFFAOYSA-N |
| SMILES | CCCCC1CNCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)