cas: 1469930-91-3 — see every product listed under this CAS number, including other names
1-Propanesulfonamide, N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 95%, 95% (CAS 1469930-91-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFX7-250mg |
| cas | 1469930-91-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6266.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (CAS 1469930-91-3) is a chemical compound with the molecular formula C15H24BNO4S and a molecular weight of 325.2 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide. InChIKey: RWCPSAPBTCXUDW-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4S |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| InChIKey | RWCPSAPBTCXUDW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NS(=O)(=O)CCC |
Computed by PubChem (NCBI)