cas: 216299-72-8 — see every product listed under this CAS number, including other names
1-Propyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide 99% (CAS 216299-72-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A997753-1g |
| cas | 216299-72-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 381.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A997753 |
Bis(trifluoromethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium (CAS 216299-72-8) is a chemical compound with the molecular formula C9H13F6N3O4S2 and a molecular weight of 405.3 g/mol. IUPAC name: bis(trifluoromethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium. InChIKey: CDWUIWLQQDTHRA-UHFFFAOYSA-N.
| Molecular formula | C9H13F6N3O4S2 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | bis(trifluoromethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium |
| InChIKey | CDWUIWLQQDTHRA-UHFFFAOYSA-N |
| SMILES | CCCN1C=C[N+](=C1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)