cas: 114932-60-4 — see every product listed under this CAS number, including other names
1-Pyrenebutyric acid N-hydroxysuccinimide ester, 97%, 97% (CAS 114932-60-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FGK-50mg |
| cas | 114932-60-4 |
| size | 50mg |
| availability | 43.999g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 102.80 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1542.80 Pln | |
| Chemat | 10g | 2574.80 Pln | |
| Chemat | 25g | 5238.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate (CAS 114932-60-4) is a chemical compound with the molecular formula C24H19NO4 and a molecular weight of 385.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate. InChIKey: YBNMDCCMCLUHBL-UHFFFAOYSA-N.
| Molecular formula | C24H19NO4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate |
| InChIKey | YBNMDCCMCLUHBL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2 |
Computed by PubChem (NCBI)