cas: 1220696-34-3 — see every product listed under this CAS number, including other names
1-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97% (CAS 1220696-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127PP-100mg |
| cas | 1220696-34-3 |
| size | 100mg |
| availability | 27.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1840.40 Pln | |
| Chemat | 25g | 4398.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (CAS 1220696-34-3) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine. InChIKey: HQQDRRKOLDTGHY-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| InChIKey | HQQDRRKOLDTGHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(C=C3)C |
Computed by PubChem (NCBI)