cas: 656257-49-7 — see every product listed under this CAS number, including other names
1-morpholino-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)ethan-1-one, 95%, 95% (CAS 656257-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTQE-250mg |
| cas | 656257-49-7 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1994.00 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-morpholin-4-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone (CAS 656257-49-7) is a chemical compound with the molecular formula C18H26BNO5 and a molecular weight of 347.2 g/mol. IUPAC name: 1-morpholin-4-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone. InChIKey: BCOZHCQIQWULQO-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO5 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 1-morpholin-4-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone |
| InChIKey | BCOZHCQIQWULQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)N3CCOCC3 |
Computed by PubChem (NCBI)