cas: 209593-18-0 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-(9-H-fluoren-9-ylmethyl) hydrogen (2R)-piperazine-1,2,4-tricarboxyl, 97% (CAS 209593-18-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO08425DA |
| cas | 209593-18-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 1282.88 Pln | |
| Thermo Scientific | 5g | 2631.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(2R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 209593-18-0) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: ZVHNNCSUTNWKFC-OAQYLSRUSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2R)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | ZVHNNCSUTNWKFC-OAQYLSRUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C[C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)