cas: 2234-09-5 — see every product listed under this CAS number, including other names
10-methyl-10H-phenothiazine 5-oxide, 95%, 95% (CAS 2234-09-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DU8-50mg |
| cas | 2234-09-5 |
| size | 50mg |
| availability | 1.39g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 328.40 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 1g | 2186.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
10-methylphenothiazine 5-oxide (CAS 2234-09-5) is a chemical compound with the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. IUPAC name: 10-methylphenothiazine 5-oxide. InChIKey: LUXDKIVXVUWRQB-UHFFFAOYSA-N.
| Molecular formula | C13H11NOS |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 10-methylphenothiazine 5-oxide |
| InChIKey | LUXDKIVXVUWRQB-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)