cas: 1024598-01-3 — see every product listed under this CAS number, including other names
11-(4,6-Diphenyl-1,3,5-triazin-2-yl)-11,12-dihydro-12-phenylindolo[2,3-a]carbazole, 99%, 99% (CAS 1024598-01-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118JD-50mg |
| cas | 1024598-01-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1355.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenylindolo[2,3-a]carbazole (CAS 1024598-01-3) is a chemical compound with the molecular formula C39H25N5 and a molecular weight of 563.6 g/mol. IUPAC name: 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenylindolo[2,3-a]carbazole. InChIKey: VBJWDGGEJNGTET-UHFFFAOYSA-N.
| Molecular formula | C39H25N5 |
|---|---|
| Molecular weight | 563.6 g/mol |
| IUPAC name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenylindolo[2,3-a]carbazole |
| InChIKey | VBJWDGGEJNGTET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N3C4=CC=CC=C4C5=C3C6=C(C=C5)C7=CC=CC=C7N6C8=CC=CC=C8)C9=CC=CC=C9 |
Computed by PubChem (NCBI)