13-Methyl-[1,3]dioxolo[4',5':4,5]benzo[1,2-c][1,3]dioxolo[4,5-i]phenanthridin-13-ium chloride, 99+%
cas: 5578-73-4 — see every product listed under this CAS number, including other names
13-Methyl-[1,3]dioxolo[4',5':4,5]benzo[1,2-c][1,3]dioxolo[4,5-i]phenanthridin-13-ium chloride, 99+% (CAS 5578-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch1149NA-1mg |
| cas | 5578-73-4 |
| size | 1mg |
| availability | 1.02g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 107.60 Pln | |
| Chemat | 10mg | 131.60 Pln | |
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 966.80 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 630.91 Pln | |
| BLDpharm | 1g | 1302.90 Pln |
properties
| purity | 99+% |
|---|---|
| delivery time | 3 weeks |
24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene chloride (CAS 5578-73-4) is a chemical compound with the molecular formula C20H14ClNO4 and a molecular weight of 367.8 g/mol. IUPAC name: 24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene chloride. InChIKey: GIZKAXHWLRYMLE-UHFFFAOYSA-M.
| Molecular formula | C20H14ClNO4 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene chloride |
| InChIKey | GIZKAXHWLRYMLE-UHFFFAOYSA-M |
| SMILES | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
SANGUINARINE CHLORIDE, Sanguinarium Chloride, Sanguinarine hydrochloride, Viadent, Sanguinarine chloride hydrate, Sanguinarine (chloride), Pseudochelerythrine chloride;Sanguinarium chloride, 13-Methyl-[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i] phenanthridinium chloride, Sanguinarine, chloride, Sanguinarium chloride [USAN:INN]