cas: 145773-22-4 — see every product listed under this CAS number, including other names
15(S)-Latanoprost 98+% (CAS 145773-22-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145140-1mg |
| cas | 145773-22-4 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 637.38 Pln | |
| Ambeed | 5mg | 1755.44 Pln | |
| Ambeed | 10mg | 2706.62 Pln | |
| Ambeed | 25mg | 5248.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A145140 |
Propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (CAS 145773-22-4) is a chemical compound with the molecular formula C26H40O5 and a molecular weight of 432.6 g/mol. IUPAC name: propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate. InChIKey: GGXICVAJURFBLW-SCTZCWPJSA-N.
| Molecular formula | C26H40O5 |
|---|---|
| Molecular weight | 432.6 g/mol |
| IUPAC name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| InChIKey | GGXICVAJURFBLW-SCTZCWPJSA-N |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CC[C@@H](CCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)