16,16-Dimethyl-14-oxo-3,6,9,12,15-pentaoxaheptadecanoic acid, 95%
cas: 1442466-57-0 — see every product listed under this CAS number, including other names
16,16-Dimethyl-14-oxo-3,6,9,12,15-pentaoxaheptadecanoic acid, 95% (CAS 1442466-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01305090-100mg |
| cas | 1442466-57-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 503.18 Pln | |
| BLDpharm | 1g | 1241.81 Pln | |
| BLDpharm | 5g | 4168.56 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2334.80 Pln | |
| Chemat | 10g | 3506.00 Pln | |
| Chemat | 25g | 6266.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 1442466-57-0) is a chemical compound with the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. IUPAC name: 2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: AIRJXXFDTSVEAV-UHFFFAOYSA-N.
| Molecular formula | C14H26O8 |
|---|---|
| Molecular weight | 322.35 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | AIRJXXFDTSVEAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
t-Butyl acetate-PEG3-CH2COOH, 16,16-Dimethyl-14-oxo-3,6,9,12,15-pentaoxaheptadecanoic acid, 14-(tert-butoxy)-14-oxo-3,6,9,12-tetraoxatetradecanoic acid, orb1984763, COOtBu-CH2-PEG3-OCH2COOH, 2-[2-[2-[2-(2-tert-butoxy-2-oxo-ethoxy)ethoxy]ethoxy]ethoxy]acetic acid, 3,6,9,12-Tetraoxatetradecanedioic acid, 1-(1,1-dimethylethyl) ester