cas: 13099-35-9 — see every product listed under this CAS number, including other names
17-Bromoheptadecanoic acid (CAS 13099-35-9) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 5 g, 500 mg, 100 mg, 250 mg, 50 mg, 1 g, 10 g. Offered by: MedChemExpress, Fluorochem.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W289559-25 g |
| cas | 13099-35-9 |
| size | 25 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 7202.10 Pln | |
| MedChemExpress | 5 g | 2158.72 Pln | |
| MedChemExpress | 500 mg | 649.42 Pln | |
| MedChemExpress | 100 mg | 282.54 Pln | |
| MedChemExpress | 250 mg | 445.08 Pln | |
| MedChemExpress | 50 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 10 g | 3658.73 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 430.07 Pln | |
| Fluorochem | 5g | 1351.63 Pln | |
| Fluorochem | 10g | 2247.14 Pln | |
| Fluorochem | 25g | 4496.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
17-bromoheptadecanoic acid (CAS 13099-35-9) is a chemical compound with the molecular formula C17H33BrO2 and a molecular weight of 349.3 g/mol. IUPAC name: 17-bromoheptadecanoic acid. InChIKey: GABSTWMSOFZKEJ-UHFFFAOYSA-N.
| Molecular formula | C17H33BrO2 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 17-bromoheptadecanoic acid |
| InChIKey | GABSTWMSOFZKEJ-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCCBr)CCCCCCCC(=O)O |
Computed by PubChem (NCBI)