CAS 754-96-1 appears in our catalog under these names: 1H,1H,10H,10H-Perfluoro-1,10-decanediol, 96%, 1H,1H,10H,10H–Perfluoro–1,10–decanediol, 1H,1H,10H,10H-Perfluoro-1,10-decanediol, 96% , 1H,1H,10H,10H-Hexadecafluoro-1,10-decanediol, >97.0%(GC), 1H,1h,10h,10h-perfluoro-1,10-decanediol 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 100g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecane-1,10-diol (CAS 754-96-1) is a chemical compound with the molecular formula C10H6F16O2 and a molecular weight of 462.13 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecane-1,10-diol. InChIKey: NSKCTPBWPZPFHW-UHFFFAOYSA-N.
| Molecular formula | C10H6F16O2 |
|---|---|
| Molecular weight | 462.13 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecane-1,10-diol |
| InChIKey | NSKCTPBWPZPFHW-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(CO)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)