cas: 330562-44-2 — see every product listed under this CAS number, including other names
1H,1H,11H,11H-Perfluoro-3,6,9-trioxaundecane-1,11-diol 98% (CAS 330562-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A495644-1g |
| cas | 330562-44-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 932.19 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2901.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A495644 |
2-[2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol (CAS 330562-44-2) is a chemical compound with the molecular formula C8H6F12O5 and a molecular weight of 410.11 g/mol. IUPAC name: 2-[2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol. InChIKey: BFMDZOWJRVLYPB-UHFFFAOYSA-N.
| Molecular formula | C8H6F12O5 |
|---|---|
| Molecular weight | 410.11 g/mol |
| IUPAC name | 2-[2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol |
| InChIKey | BFMDZOWJRVLYPB-UHFFFAOYSA-N |
| SMILES | C(C(OC(C(OC(C(OC(CO)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)