CAS 30389-25-4 appears in our catalog under these names: 1H,1H,2H-Perfluoro-1-dodecene, 95%, 1H,1H,2H-Perfluoro-1-dodecene, >95% (GC), 1H,1H,2H–Perfluoro–1–dodecene, 1H,1H,2H-Perfluoro-1-dodecene, 97% . Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g, 1g, 5g, 250mg, 500mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododec-1-ene (CAS 30389-25-4) is a chemical compound with the molecular formula C12H3F21 and a molecular weight of 546.12 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododec-1-ene. InChIKey: UCHSAVGOZUCXHC-UHFFFAOYSA-N.
| Molecular formula | C12H3F21 |
|---|---|
| Molecular weight | 546.12 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododec-1-ene |
| InChIKey | UCHSAVGOZUCXHC-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)