cas: 19430-93-4 — see every product listed under this CAS number, including other names
1H,1H,2H-Perfluorohexene (CAS 19430-93-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007057-5G |
| cas | 19430-93-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 487.35 Pln |
| delivery time | 2-3 weeks |
|---|
3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene (CAS 19430-93-4) is a chemical compound with the molecular formula C6H3F9 and a molecular weight of 246.07 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene. InChIKey: GVEUEBXMTMZVSD-UHFFFAOYSA-N.
| Molecular formula | C6H3F9 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
| InChIKey | GVEUEBXMTMZVSD-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)