cas: 16627-71-7 — see every product listed under this CAS number, including other names
1H,1H,5H-Octafluoropentyl 1,1,2,2-Tetrafluoroethyl Ether, >98.0%(GC) (CAS 16627-71-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0422-5G |
| cas | 16627-71-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 247.68 Pln | |
| TCI | 25g | 577.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,1,2,2,3,3,4,4-octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane (CAS 16627-71-7) is a chemical compound with the molecular formula C7H4F12O and a molecular weight of 332.09 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane. InChIKey: ZNBGTBKGFZMWKR-UHFFFAOYSA-N.
| Molecular formula | C7H4F12O |
|---|---|
| Molecular weight | 332.09 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |
| InChIKey | ZNBGTBKGFZMWKR-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)F)(F)F)(F)F)(F)F)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)