cas: 335-99-9 — see every product listed under this CAS number, including other names
1H,1h,7h-dodecafluoro-1-heptanol, 95%, 95% (CAS 335-99-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ECV-5g |
| cas | 335-99-9 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 280.40 Pln | |
| Chemat | 500g | 1180.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-ol (CAS 335-99-9) is a chemical compound with the molecular formula C7H4F12O and a molecular weight of 332.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-ol. InChIKey: BYKNGMLDSIEFFG-UHFFFAOYSA-N.
| Molecular formula | C7H4F12O |
|---|---|
| Molecular weight | 332.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-ol |
| InChIKey | BYKNGMLDSIEFFG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)