Products 14209-41-7
CAS 14209-41-7 appears in our catalog under these names: 1H-Indene-3-carboxylic acid, 97%, 97%, 1H-Indene-3-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 2.5g, 10g.
3H-indene-1-carboxylic acid (CAS 14209-41-7) is a chemical compound with the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. IUPAC name: 3H-indene-1-carboxylic acid. InChIKey: NZSCUDBGUBVDLO-UHFFFAOYSA-N.
| Molecular formula | C10H8O2 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 3H-indene-1-carboxylic acid |
| InChIKey | NZSCUDBGUBVDLO-UHFFFAOYSA-N |
| SMILES | C1C=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)