cas: 1256802-03-5 — see every product listed under this CAS number, including other names
1H-Pyrazolo[4,3-c]pyridine-6-carboxylic acid, 95% (CAS 1256802-03-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25mg, 50mg, 100mg, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-6780-1g |
| cas | 1256802-03-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Fluorochem | 25mg | 529.00 Pln | |
| Fluorochem | 50mg | 924.69 Pln | |
| Fluorochem | 100mg | 1294.35 Pln | |
| Fluorochem | 250mg | 2018.06 Pln | |
| Fluorochem | 1g | 6256.15 Pln | |
| Fluorochem | 5g | 20917.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1H-pyrazolo[4,3-c]pyridine-6-carboxylic acid (CAS 1256802-03-5) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 1H-pyrazolo[4,3-c]pyridine-6-carboxylic acid. InChIKey: OAQMLQAXJBDDDJ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1H-pyrazolo[4,3-c]pyridine-6-carboxylic acid |
| InChIKey | OAQMLQAXJBDDDJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1C(=O)O)C=NN2 |
Computed by PubChem (NCBI)