cas: 94315-53-4 — see every product listed under this CAS number, including other names
1H-benzimidazole, 2-(4-ethenylphenyl)-1-methyl-, 95%, 95% (CAS 94315-53-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149IX-250mg |
| cas | 94315-53-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-ethenylphenyl)-1-methylbenzimidazole (CAS 94315-53-4) is a chemical compound with the molecular formula C16H14N2 and a molecular weight of 234.29 g/mol. IUPAC name: 2-(4-ethenylphenyl)-1-methylbenzimidazole. InChIKey: JPOCVGKMJUFJOD-UHFFFAOYSA-N.
| Molecular formula | C16H14N2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-1-methylbenzimidazole |
| InChIKey | JPOCVGKMJUFJOD-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N=C1C3=CC=C(C=C3)C=C |
Computed by PubChem (NCBI)