cas: 62972-61-6 — see every product listed under this CAS number, including other names
1H-benzotriazole-7-carboxylic acid, 98% (CAS 62972-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EG6V-1g |
| cas | 62972-61-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1029.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2H-benzotriazole-4-carboxylic acid (CAS 62972-61-6) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2H-benzotriazole-4-carboxylic acid. InChIKey: KFJDQPJLANOOOB-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2H-benzotriazole-4-carboxylic acid |
| InChIKey | KFJDQPJLANOOOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)