2'-Bromo-2,4,6-triisopropyl-1,1'-biphenyl, 95%
cas: 1382646-51-6 — see every product listed under this CAS number, including other names
2'-Bromo-2,4,6-triisopropyl-1,1'-biphenyl, 95% (CAS 1382646-51-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1688877-10g |
| cas | 1382646-51-6 |
| size | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1566.31 Pln | |
| Ambeed | 25g | 3062.62 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 414.32 Pln | |
| BLDpharm | 5g | 991.90 Pln | |
| BLDpharm | 10g | 1686.10 Pln | |
| BLDpharm | 25g | 3302.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 923.60 Pln | |
| Chemat | 10g | 1571.60 Pln | |
| Chemat | 25g | 3078.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-bromophenyl)-1,3,5-tri(propan-2-yl)benzene (CAS 1382646-51-6) is a chemical compound with the molecular formula C21H27Br and a molecular weight of 359.3 g/mol. IUPAC name: 2-(2-bromophenyl)-1,3,5-tri(propan-2-yl)benzene. InChIKey: BUDPPJGEOYUCMK-UHFFFAOYSA-N.
| Molecular formula | C21H27Br |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1,3,5-tri(propan-2-yl)benzene |
| InChIKey | BUDPPJGEOYUCMK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2Br)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2'-bromo-2,4,6-triisopropyl-1,1'-biphenyl, 2-Bromo-2',4',6'-triisopropylbiphenyl, 2-(2-bromophenyl)-1,3,5-tri(propan-2-yl)benzene, 2'-Bromo-2,4,6-tris(1-methylethyl)-1,1'-biphenyl, C21H27Br, 2-(2-bromophenyl)-1,3,5-triisopropyl-benzene, 1,1'-Biphenyl, 2'-bromo-2,4,6-tris(1-methylethyl)-, 2 inverted exclamation mark -Bromo-2,4,6-triisopropylbiphenyl