2'-Methoxyphenyl acetylene, 97%
cas: 767-91-9 — see every product listed under this CAS number, including other names
2'-Methoxyphenyl acetylene, 97% (CAS 767-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 15g. Offered by: BLDpharm, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD7609-250mg |
| cas | 767-91-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 219.95 Pln | |
| BLDpharm | 10g | 331.02 Pln | |
| BLDpharm | 25g | 719.77 Pln | |
| BLDpharm | 100g | 2663.53 Pln | |
| BLDpharm | 500g | 10455.23 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 310.32 Pln | |
| Fluorochem | 25g | 664.37 Pln | |
| Fluorochem | 100g | 2444.99 Pln | |
| Fluorochem | 15g | 424.87 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-ethynyl-2-methoxybenzene (CAS 767-91-9) is a chemical compound with the molecular formula C9H8O and a molecular weight of 132.16 g/mol. IUPAC name: 1-ethynyl-2-methoxybenzene. InChIKey: UFOVULIWACVAAC-UHFFFAOYSA-N.
| Molecular formula | C9H8O |
|---|---|
| Molecular weight | 132.16 g/mol |
| IUPAC name | 1-ethynyl-2-methoxybenzene |
| InChIKey | UFOVULIWACVAAC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C#C |
Computed by PubChem (NCBI)
Synonyms:
1-Ethynyl-2-methoxybenzene, benzene, 1-ethynyl-2-methoxy-, InChI=1/C9H8O/c1-3-8-6-4-5-7-9(8)10-2/h1,4-7H,2H, 2'-Methoxyphenyl acetylene, 2-Ethynylanisole, 2-Methoxyphenylacetylene, 1-ethynyl-2-methoxy-benzene, 2'-Methoxyphenylacetylene, 1-ethynyl-2-methoxybenzen, 1-Ethynyl-2-methoxybenzene #