cas: 518997-91-6 — see every product listed under this CAS number, including other names
2,2'':7'',2''''-Ter-9,9'-spirobi[9H-fluorene], >98.0%(HPLC) (CAS 518997-91-6) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3433-200MG |
| cas | 518997-91-6 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 383.88 Pln | |
| TCI | 1g | 1239.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene] (CAS 518997-91-6) is a chemical compound with the molecular formula C75H44 and a molecular weight of 945.1 g/mol. IUPAC name: 2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene]. InChIKey: BFDFHGPJXDFXBA-UHFFFAOYSA-N.
| Molecular formula | C75H44 |
|---|---|
| Molecular weight | 945.1 g/mol |
| IUPAC name | 2',7'-bis(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene] |
| InChIKey | BFDFHGPJXDFXBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)C7=CC8=C(C=C7)C9=C(C81C2=CC=CC=C2C2=CC=CC=C12)C=C(C=C9)C1=CC2=C(C=C1)C1=CC=CC=C1C21C2=CC=CC=C2C2=CC=CC=C12 |
Computed by PubChem (NCBI)