2,2',2''-(10-(2-(4-Nitrophenoxy)-2-oxoethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid, 95%
cas: 474424-15-2 — see every product listed under this CAS number, including other names
2,2',2''-(10-(2-(4-Nitrophenoxy)-2-oxoethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid, 95% (CAS 474424-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1374421-100mg |
| cas | 474424-15-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1099.06 Pln | |
| Ambeed | 250mg | 1866.69 Pln | |
| Ambeed | 1g | 4686.88 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 1g | 4542.80 Pln | |
| BLDpharm | 50mg | 675.34 Pln | |
| BLDpharm | 100mg | 1075.20 Pln | |
| BLDpharm | 250mg | 1830.49 Pln | |
| BLDpharm | 1g | 4601.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[4,10-bis(carboxymethyl)-7-[2-(4-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (CAS 474424-15-2) is a chemical compound with the molecular formula C22H31N5O10 and a molecular weight of 525.5 g/mol. IUPAC name: 2-[4,10-bis(carboxymethyl)-7-[2-(4-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid. InChIKey: JGXSCONDUFFXIF-UHFFFAOYSA-N.
| Molecular formula | C22H31N5O10 |
|---|---|
| Molecular weight | 525.5 g/mol |
| IUPAC name | 2-[4,10-bis(carboxymethyl)-7-[2-(4-nitrophenoxy)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| InChIKey | JGXSCONDUFFXIF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)O)CC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)