cas: 2200-71-7 — see every product listed under this CAS number, including other names
2,2',3,3',5,5',6,6'-Octafluoro-4,4'-dimethoxy-1,1'-biphenyl (CAS 2200-71-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 5g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KFN-200mg |
| cas | 2200-71-7 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 102.80 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 1g | 170.00 Pln |
| delivery time | 3 weeks |
|---|
1,2,4,5-tetrafluoro-3-methoxy-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene (CAS 2200-71-7) is a chemical compound with the molecular formula C14H6F8O2 and a molecular weight of 358.18 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-methoxy-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene. InChIKey: TVUPJKALGKCABC-UHFFFAOYSA-N.
| Molecular formula | C14H6F8O2 |
|---|---|
| Molecular weight | 358.18 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-methoxy-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene |
| InChIKey | TVUPJKALGKCABC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)C2=C(C(=C(C(=C2F)F)OC)F)F)F)F |
Computed by PubChem (NCBI)