cas: 92379-42-5 — see every product listed under this CAS number, including other names
2,2',3,4,4'-Pentahydroxybenzophenone, 95%, 95% (CAS 92379-42-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSFR-100mg |
| cas | 92379-42-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,4-dihydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone (CAS 92379-42-5) is a chemical compound with the molecular formula C13H10O6 and a molecular weight of 262.21 g/mol. IUPAC name: (2,4-dihydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone. InChIKey: GBQZZLQKUYLGFT-UHFFFAOYSA-N.
| Molecular formula | C13H10O6 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | (2,4-dihydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone |
| InChIKey | GBQZZLQKUYLGFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C(=O)C2=C(C(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)