2,2',7,7'-Tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene], 95%
cas: 934391-22-7 — see every product listed under this CAS number, including other names
2,2',7,7'-Tetrakis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene], 95% (CAS 934391-22-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1512486-250mg |
| cas | 934391-22-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1733.19 Pln | |
| Ambeed | 5g | 5827.19 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5334.80 Pln | |
| BLDpharm | 100mg | 430.98 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1697.20 Pln | |
| BLDpharm | 5g | 5712.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-[2',7,7'-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane (CAS 934391-22-7) is a chemical compound with the molecular formula C49H60B4O8 and a molecular weight of 820.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2',7,7'-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane. InChIKey: FZXHNTCTFRYPRM-UHFFFAOYSA-N.
| Molecular formula | C49H60B4O8 |
|---|---|
| Molecular weight | 820.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2',7,7'-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane |
| InChIKey | FZXHNTCTFRYPRM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=C(C35C6=C(C=CC(=C6)B7OC(C(O7)(C)C)(C)C)C8=C5C=C(C=C8)B9OC(C(O9)(C)C)(C)C)C=C(C=C4)B1OC(C(O1)(C)C)(C)C |
Computed by PubChem (NCBI)