cas: 189363-47-1 — see every product listed under this CAS number, including other names
2,2',7,7'-Tetrakis(diphenylamino)-9,9'-spirobi[9H-fluorene], 97% (CAS 189363-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F876219-100MG |
| cas | 189363-47-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 25g | 6875.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis-phenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS 189363-47-1) is a chemical compound with the molecular formula C73H52N4 and a molecular weight of 985.2 g/mol. IUPAC name: 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis-phenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine. InChIKey: MQRCTQVBZYBPQE-UHFFFAOYSA-N.
| Molecular formula | C73H52N4 |
|---|---|
| Molecular weight | 985.2 g/mol |
| IUPAC name | 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis-phenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| InChIKey | MQRCTQVBZYBPQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C5=C(C46C7=C(C=CC(=C7)N(C8=CC=CC=C8)C9=CC=CC=C9)C1=C6C=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1)C=C(C=C5)N(C1=CC=CC=C1)C1=CC=CC=C1 |
Computed by PubChem (NCBI)