cas: 1999-85-5 — see every product listed under this CAS number, including other names
2,2'-(1,3-Phenylene)bis(propan-2-ol), 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 1999-85-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NRM-5g |
| cas | 1999-85-5 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 630.80 Pln | |
| Chemat | 500g | 2404.80 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-[3-(2-hydroxypropan-2-yl)phenyl]propan-2-ol (CAS 1999-85-5) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 2-[3-(2-hydroxypropan-2-yl)phenyl]propan-2-ol. InChIKey: UGPWRRVOLLMHSC-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 2-[3-(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| InChIKey | UGPWRRVOLLMHSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)C(C)(C)O)O |
Computed by PubChem (NCBI)