cas: 791-22-0 — see every product listed under this CAS number, including other names
2,2'-(2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diyl)bis(oxirane), >98.0%(GC) (CAS 791-22-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0469-5G |
| cas | 791-22-0 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 629.74 Pln | |
| TCI | 25g | 2395.03 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-[2,2,3,3,4,4,5,5-octafluoro-6-(oxiran-2-yl)hexyl]oxirane (CAS 791-22-0) is a chemical compound with the molecular formula C10H10F8O2 and a molecular weight of 314.17 g/mol. IUPAC name: 2-[2,2,3,3,4,4,5,5-octafluoro-6-(oxiran-2-yl)hexyl]oxirane. InChIKey: KVSHGEMJMXSNTB-UHFFFAOYSA-N.
| Molecular formula | C10H10F8O2 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | 2-[2,2,3,3,4,4,5,5-octafluoro-6-(oxiran-2-yl)hexyl]oxirane |
| InChIKey | KVSHGEMJMXSNTB-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C(C(C(CC2CO2)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)