2,2'-(4,5,6-Trifluoro-1,3-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane), 97%
cas: 1073339-14-6 — see every product listed under this CAS number, including other names
2,2'-(4,5,6-Trifluoro-1,3-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane), 97% (CAS 1073339-14-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A539625-250mg |
| cas | 1073339-14-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1321.56 Pln | |
| BLDpharm | 25mg | 281.04 Pln | |
| BLDpharm | 50mg | 325.47 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 530.95 Pln | |
| BLDpharm | 1g | 1413.97 Pln | |
| Chemat | 25mg | 280.40 Pln | |
| Chemat | 50mg | 352.40 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1907.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-[2,3,4-trifluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane (CAS 1073339-14-6) is a chemical compound with the molecular formula C18H25B2F3O4 and a molecular weight of 384.0 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2,3,4-trifluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: GUZIQVMHGOZWTN-UHFFFAOYSA-N.
| Molecular formula | C18H25B2F3O4 |
|---|---|
| Molecular weight | 384.0 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2,3,4-trifluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GUZIQVMHGOZWTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)F)F)B3OC(C(O3)(C)C)(C)C |
Computed by PubChem (NCBI)
