cas: 120511-72-0 — see every product listed under this CAS number, including other names
2,2'-(5-Methyl-1,3-phenylene)bis(2-methylpropanenitrile), 98% (CAS 120511-72-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211279-5G |
| cas | 120511-72-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 940.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-(2-cyanopropan-2-yl)-5-methylphenyl]-2-methylpropanenitrile (CAS 120511-72-0) is a chemical compound with the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. IUPAC name: 2-[3-(2-cyanopropan-2-yl)-5-methylphenyl]-2-methylpropanenitrile. InChIKey: SJECEXNMZXMXNE-UHFFFAOYSA-N.
| Molecular formula | C15H18N2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 2-[3-(2-cyanopropan-2-yl)-5-methylphenyl]-2-methylpropanenitrile |
| InChIKey | SJECEXNMZXMXNE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C#N)C(C)(C)C#N |
Computed by PubChem (NCBI)