cas: 3236-63-3 — see every product listed under this CAS number, including other names
2,2'-Methylenebis(4-methylphenol) (~90%), 90%, 90% (CAS 3236-63-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FCD-5g |
| cas | 3236-63-3 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 237.20 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol (CAS 3236-63-3) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol. InChIKey: XZXYQEHISUMZAT-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
| InChIKey | XZXYQEHISUMZAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)CC2=C(C=CC(=C2)C)O |
Computed by PubChem (NCBI)