cas: 7764-29-6 — see every product listed under this CAS number, including other names
2,2'-Thiobis[1H-isoindole-1,3(2H)-dione], 95%, 95% (CAS 7764-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147I9-100mg |
| cas | 7764-29-6 |
| size | 100mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 500mg | 371.60 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4888.40 Pln | |
| Chemat | 50g | 8915.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione (CAS 7764-29-6) is a chemical compound with the molecular formula C16H8N2O4S and a molecular weight of 324.3 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione. InChIKey: QYIWBOWEQBEAGP-UHFFFAOYSA-N.
| Molecular formula | C16H8N2O4S |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione |
| InChIKey | QYIWBOWEQBEAGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)SN3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)